C25H38N4O5S — CID 4585157
N-[4-[2-(2-acetamidoethylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]cyclobutanecarboxamide (PubChem CID 4585157) has the molecular formula C25H38N4O5S and a molecular weight of 506.67 g/mol. Its IUPAC name is N-[4-[2-(2-acetamidoethylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]cyclobutanecarboxamide.
| Compound Name | N-[4-[2-(2-acetamidoethylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 4585157 |
| Molecular Formula | C25H38N4O5S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | N-[4-[2-(2-acetamidoethylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]cyclobutanecarboxamide |
| SMILES | CC(=O)NCCNC(=O)CC1c2nc(NC(=O)C3CCC3)sc2CC2C(C)(CO)C(O)CCC12C |
| InChI | InChI=1S/C25H38N4O5S/c1-14(31)26-9-10-27-20(33)11-16-21-17(35-23(28-21)29-22(34)15-5-4-6-15)12-18-24(16,2)8-7-19(32)25(18,3)13-30/h15-16,18-19,30,32H,4-13H2,1-3H3,(H,26,31)(H,27,33)(H,28,29,34) |
| InChIKey | OINNWIJVSUTDLM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|