C21H29N2O5S- — CID 11883103
2-[(4S,4aR,7R,8R,8aS)-2-(cyclobutanecarbonylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetate (PubChem CID 11883103) has the molecular formula C21H29N2O5S- and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[(4S,4aR,7R,8R,8aS)-2-(cyclobutanecarbonylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetate.
| Compound Name | 2-[(4S,4aR,7R,8R,8aS)-2-(cyclobutanecarbonylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetate |
|---|---|
| PubChem CID | 11883103 |
| Molecular Formula | C21H29N2O5S- |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[(4S,4aR,7R,8R,8aS)-2-(cyclobutanecarbonylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetate |
| SMILES | C[C@]1(CO)[C@H]2Cc3sc(NC(=O)C4CCC4)nc3[C@@H](CC(=O)[O-])[C@]2(C)CC[C@H]1O |
| InChI | InChI=1S/C21H30N2O5S/c1-20-7-6-15(25)21(2,10-24)14(20)9-13-17(12(20)8-16(26)27)22-19(29-13)23-18(28)11-4-3-5-11/h11-12,14-15,24-25H,3-10H2,1-2H3,(H,26,27)(H,22,23,28)/p-1/t12-,14+,15-,20+,21+/m1/s1 |
| InChIKey | FIUBOQIGOFBUDN-ZPYSQEIBSA-M |
| XLogP | 1.44 |
| TPSA | 122.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |