C25H35N3O4S — CID 3852684
N-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4-[2-[methyl(prop-2-ynyl)amino]-2-oxoethyl]-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]cyclobutanecarboxamide (PubChem CID 3852684) has the molecular formula C25H35N3O4S and a molecular weight of 473.64 g/mol. Its IUPAC name is N-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4-[2-[methyl(prop-2-ynyl)amino]-2-oxoethyl]-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]cyclobutanecarboxamide.
| Compound Name | N-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4-[2-[methyl(prop-2-ynyl)amino]-2-oxoethyl]-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 3852684 |
| Molecular Formula | C25H35N3O4S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4-[2-[methyl(prop-2-ynyl)amino]-2-oxoethyl]-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]cyclobutanecarboxamide |
| SMILES | C#CCN(C)C(=O)CC1c2nc(NC(=O)C3CCC3)sc2CC2C(C)(CO)C(O)CCC12C |
| InChI | InChI=1S/C25H35N3O4S/c1-5-11-28(4)20(31)12-16-21-17(33-23(26-21)27-22(32)15-7-6-8-15)13-18-24(16,2)10-9-19(30)25(18,3)14-29/h1,15-16,18-19,29-30H,6-14H2,2-4H3,(H,26,27,32) |
| InChIKey | LASUNKTYOPSHRP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|