C24H30N2O3S2 — CID 3759078
2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-thiophen-3-yl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-ynylacetamide (PubChem CID 3759078) has the molecular formula C24H30N2O3S2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-thiophen-3-yl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-ynylacetamide.
| Compound Name | 2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-thiophen-3-yl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 3759078 |
| Molecular Formula | C24H30N2O3S2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-thiophen-3-yl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-ynylacetamide |
| SMILES | C#CCN(C)C(=O)CC1c2nc(-c3ccsc3)sc2CC2C(C)(CO)C(O)CCC12C |
| InChI | InChI=1S/C24H30N2O3S2/c1-5-9-26(4)20(29)11-16-21-17(31-22(25-21)15-7-10-30-13-15)12-18-23(16,2)8-6-19(28)24(18,3)14-27/h1,7,10,13,16,18-19,27-28H,6,8-9,11-12,14H2,2-4H3 |
| InChIKey | SUNXMVAVXSLRID-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|