About 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide
2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide (PubChem CID 3533533) has the molecular formula C20H16ClN5OS
and a molecular weight of 409.90 g/mol. Its IUPAC name is 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide.
Molecular Properties
| Compound Name | 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide |
| PubChem CID | 3533533 |
| Molecular Formula | C20H16ClN5OS |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide |
| SMILES | O=C(CSc1ncnc2c1cnn2Cc1ccccc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H16ClN5OS/c21-15-7-4-8-16(9-15)25-18(27)12-28-20-17-10-24-26(19(17)22-13-23-20)11-14-5-2-1-3-6-14/h1-10,13H,11-12H2,(H,25,27) |
| InChIKey | AFVUFRTUBPZDDK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide?
The IUPAC name of 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide (CID 3533533) is 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide.
What is the SMILES notation for 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide?
The canonical SMILES for 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide is O=C(CSc1ncnc2c1cnn2Cc1ccccc1)Nc1cccc(Cl)c1.
What is the InChIKey of 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide?
The InChIKey is AFVUFRTUBPZDDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN5OS/c21-15-7-4-8-16(9-15)25-18(27)12-28-20-17-10-24-26(19(17)22-13-23-20)11-14-5-2-1-3-6-14/h1-10,13H,11-12H2,(H,25,27).
What are the key properties of 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide?
2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide has a molecular weight of 409.90 g/mol, XLogP of 4.26, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanyl-N-(3-chlorophenyl)acetamide is sourced from PubChem (CID 3533533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).