C23H24N2O3 — CID 3534185
1-[isoquinolin-6-yl-(4-methoxyphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 3534185) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[isoquinolin-6-yl-(4-methoxyphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[isoquinolin-6-yl-(4-methoxyphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3534185 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[isoquinolin-6-yl-(4-methoxyphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc(C(c2ccc3cnccc3c2)N2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-28-21-6-4-16(5-7-21)22(25-12-9-17(10-13-25)23(26)27)19-2-3-20-15-24-11-8-18(20)14-19/h2-8,11,14-15,17,22H,9-10,12-13H2,1H3,(H,26,27) |
| InChIKey | UHMKSXODRWQYLU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |