C20H20Cl2N4O4 — CID 3534204
1-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-N-(2-methoxyphenyl)-5-methyl-1,2,4-triazole-3-carboxamide (PubChem CID 3534204) has the molecular formula C20H20Cl2N4O4 and a molecular weight of 451.31 g/mol. Its IUPAC name is 1-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-N-(2-methoxyphenyl)-5-methyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-N-(2-methoxyphenyl)-5-methyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 3534204 |
| Molecular Formula | C20H20Cl2N4O4 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 1-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-N-(2-methoxyphenyl)-5-methyl-1,2,4-triazole-3-carboxamide |
| SMILES | COCCOc1cc(-n2nc(C(=O)Nc3ccccc3OC)nc2C)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H20Cl2N4O4/c1-12-23-19(20(27)24-15-6-4-5-7-17(15)29-3)25-26(12)16-11-18(30-9-8-28-2)14(22)10-13(16)21/h4-7,10-11H,8-9H2,1-3H3,(H,24,27) |
| InChIKey | WDPUOFADAIFZRR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|