C24H24FN3O4 — CID 35343180
N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-1-(4-fluorobenzoyl)piperidine-4-carboxamide (PubChem CID 35343180) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-1-(4-fluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 35343180 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(CN2C(=O)CCC2=O)cc1)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H24FN3O4/c25-19-5-3-18(4-6-19)24(32)27-13-11-17(12-14-27)23(31)26-20-7-1-16(2-8-20)15-28-21(29)9-10-22(28)30/h1-8,17H,9-15H2,(H,26,31) |
| InChIKey | CXHYIRAAFBDIJN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|