C19H14ClF2NO5 — CID 35386075
[2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2H-chromene-3-carboxylate (PubChem CID 35386075) has the molecular formula C19H14ClF2NO5 and a molecular weight of 409.77 g/mol. Its IUPAC name is [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2H-chromene-3-carboxylate.
| Compound Name | [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 35386075 |
| Molecular Formula | C19H14ClF2NO5 |
| Molecular Weight | 409.77 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2H-chromene-3-carboxylate |
| SMILES | O=C(COC(=O)C1=Cc2ccccc2OC1)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C19H14ClF2NO5/c20-14-8-13(5-6-16(14)28-19(21)22)23-17(24)10-27-18(25)12-7-11-3-1-2-4-15(11)26-9-12/h1-8,19H,9-10H2,(H,23,24) |
| InChIKey | JSOBJIPDMYEDKN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.77 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |