C28H35Cl2N5O3 — CID 3539264
N-[3-tert-butyl-1-(2,4-dimethylphenyl)pyrazol-5-yl]-2-[(2,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]acetamide (PubChem CID 3539264) has the molecular formula C28H35Cl2N5O3 and a molecular weight of 560.53 g/mol. Its IUPAC name is N-[3-tert-butyl-1-(2,4-dimethylphenyl)pyrazol-5-yl]-2-[(2,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]acetamide.
| Compound Name | N-[3-tert-butyl-1-(2,4-dimethylphenyl)pyrazol-5-yl]-2-[(2,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]acetamide |
|---|---|
| PubChem CID | 3539264 |
| Molecular Formula | C28H35Cl2N5O3 |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | N-[3-tert-butyl-1-(2,4-dimethylphenyl)pyrazol-5-yl]-2-[(2,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]acetamide |
| SMILES | COCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(C)cc1C)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H35Cl2N5O3/c1-18-8-11-23(19(2)14-18)35-25(16-24(33-35)28(3,4)5)32-26(36)17-34(12-7-13-38-6)27(37)31-22-10-9-20(29)15-21(22)30/h8-11,14-16H,7,12-13,17H2,1-6H3,(H,31,37)(H,32,36) |
| InChIKey | BTMMGUIAWYPAQG-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|