C27H33Cl2N5O3 — CID 4660155
N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-2-[(2,6-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]acetamide (PubChem CID 4660155) has the molecular formula C27H33Cl2N5O3 and a molecular weight of 546.50 g/mol. Its IUPAC name is N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-2-[(2,6-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]acetamide.
| Compound Name | N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-2-[(2,6-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]acetamide |
|---|---|
| PubChem CID | 4660155 |
| Molecular Formula | C27H33Cl2N5O3 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-2-[(2,6-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]acetamide |
| SMILES | COCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1cccc(C)c1)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H33Cl2N5O3/c1-18-9-6-10-19(15-18)34-23(16-22(32-34)27(2,3)4)30-24(35)17-33(13-8-14-37-5)26(36)31-25-20(28)11-7-12-21(25)29/h6-7,9-12,15-16H,8,13-14,17H2,1-5H3,(H,30,35)(H,31,36) |
| InChIKey | AREZTSNFHQJGQB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|