C25H37ClN4O3 — CID 42735445
N-[2-[[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-3-chloro-N-(3-methoxypropyl)-2,2-dimethylpropanamide (PubChem CID 42735445) has the molecular formula C25H37ClN4O3 and a molecular weight of 477.05 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-3-chloro-N-(3-methoxypropyl)-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-3-chloro-N-(3-methoxypropyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 42735445 |
| Molecular Formula | C25H37ClN4O3 |
| Molecular Weight | 477.05 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-3-chloro-N-(3-methoxypropyl)-2,2-dimethylpropanamide |
| SMILES | COCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1cccc(C)c1)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C25H37ClN4O3/c1-18-10-8-11-19(14-18)30-21(15-20(28-30)24(2,3)4)27-22(31)16-29(12-9-13-33-7)23(32)25(5,6)17-26/h8,10-11,14-15H,9,12-13,16-17H2,1-7H3,(H,27,31) |
| InChIKey | AIPPIWZCXZJUJE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.05 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|