C27H36N4O4S — CID 3311141
N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]acetamide (PubChem CID 3311141) has the molecular formula C27H36N4O4S and a molecular weight of 512.68 g/mol. Its IUPAC name is N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 3311141 |
| Molecular Formula | C27H36N4O4S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]acetamide |
| SMILES | COCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1cccc(C)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H36N4O4S/c1-20-11-13-23(14-12-20)36(33,34)30(15-8-16-35-6)19-26(32)28-25-18-24(27(3,4)5)29-31(25)22-10-7-9-21(2)17-22/h7,9-14,17-18H,8,15-16,19H2,1-6H3,(H,28,32) |
| InChIKey | JSXWBSZZJGTVQA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|