C30H42N4O4S — CID 3887743
N-[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]-2-[(4-tert-butylphenyl)sulfonyl-(3-methoxypropyl)amino]acetamide (PubChem CID 3887743) has the molecular formula C30H42N4O4S and a molecular weight of 554.76 g/mol. Its IUPAC name is N-[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]-2-[(4-tert-butylphenyl)sulfonyl-(3-methoxypropyl)amino]acetamide.
| Compound Name | N-[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]-2-[(4-tert-butylphenyl)sulfonyl-(3-methoxypropyl)amino]acetamide |
|---|---|
| PubChem CID | 3887743 |
| Molecular Formula | C30H42N4O4S |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | N-[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]-2-[(4-tert-butylphenyl)sulfonyl-(3-methoxypropyl)amino]acetamide |
| SMILES | COCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1C)S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H42N4O4S/c1-22-12-9-10-13-25(22)34-27(20-26(32-34)30(5,6)7)31-28(35)21-33(18-11-19-38-8)39(36,37)24-16-14-23(15-17-24)29(2,3)4/h9-10,12-17,20H,11,18-19,21H2,1-8H3,(H,31,35) |
| InChIKey | WTLSFRGLKNSLPR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|