C28H39N7O12S2 — CID 3542746
2-[bis[2-[carboxymethyl-[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl]amino]ethyl]amino]acetic acid (PubChem CID 3542746) has the molecular formula C28H39N7O12S2 and a molecular weight of 729.79 g/mol. Its IUPAC name is 2-[bis[2-[carboxymethyl-[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 3542746 |
| Molecular Formula | C28H39N7O12S2 |
| Molecular Weight | 729.79 g/mol |
| Exact Mass | 729.21 |
| IUPAC Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl]amino]ethyl]amino]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NCc2ccc(S(N)(=O)=O)cc2)CC(=O)O)CC(=O)O)cc1 |
| InChI | InChI=1S/C28H39N7O12S2/c29-48(44,45)22-5-1-20(2-6-22)13-31-24(36)15-34(18-27(40)41)11-9-33(17-26(38)39)10-12-35(19-28(42)43)16-25(37)32-14-21-3-7-23(8-4-21)49(30,46)47/h1-8H,9-19H2,(H,31,36)(H,32,37)(H,38,39)(H,40,41)(H,42,43)(H2,29,44,45)(H2,30,46,47) |
| InChIKey | RSPXQWLZLVDDAI-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 300.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.79 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |