C21H15ClFN3O2 — CID 3543869
1-(2-chlorophenyl)-N-(2-fluorophenyl)-3-(5-methylfuran-2-yl)pyrazole-5-carboxamide (PubChem CID 3543869) has the molecular formula C21H15ClFN3O2 and a molecular weight of 395.82 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(2-fluorophenyl)-3-(5-methylfuran-2-yl)pyrazole-5-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(2-fluorophenyl)-3-(5-methylfuran-2-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3543869 |
| Molecular Formula | C21H15ClFN3O2 |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(2-fluorophenyl)-3-(5-methylfuran-2-yl)pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3ccccc3F)n(-c3ccccc3Cl)n2)o1 |
| InChI | InChI=1S/C21H15ClFN3O2/c1-13-10-11-20(28-13)17-12-19(21(27)24-16-8-4-3-7-15(16)23)26(25-17)18-9-5-2-6-14(18)22/h2-12H,1H3,(H,24,27) |
| InChIKey | SQDUZQUKJGRXCC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |