C19H20ClN3O2 — CID 7271587
N-[(2S)-butan-2-yl]-1-(2-chlorophenyl)-3-(5-methylfuran-2-yl)pyrazole-5-carboxamide (PubChem CID 7271587) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-1-(2-chlorophenyl)-3-(5-methylfuran-2-yl)pyrazole-5-carboxamide.
| Compound Name | N-[(2S)-butan-2-yl]-1-(2-chlorophenyl)-3-(5-methylfuran-2-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 7271587 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[(2S)-butan-2-yl]-1-(2-chlorophenyl)-3-(5-methylfuran-2-yl)pyrazole-5-carboxamide |
| SMILES | CC[C@H](C)NC(=O)c1cc(-c2ccc(C)o2)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C19H20ClN3O2/c1-4-12(2)21-19(24)17-11-15(18-10-9-13(3)25-18)22-23(17)16-8-6-5-7-14(16)20/h5-12H,4H2,1-3H3,(H,21,24)/t12-/m0/s1 |
| InChIKey | NHXCIXRRLRFXDX-LBPRGKRZSA-N |
| XLogP | 4.62 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |