C24H44O4Si2 — CID 3545122
1-[2-[1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 3545122) has the molecular formula C24H44O4Si2 and a molecular weight of 452.78 g/mol. Its IUPAC name is 1-[2-[1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | 1-[2-[1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 3545122 |
| Molecular Formula | C24H44O4Si2 |
| Molecular Weight | 452.78 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 1-[2-[1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | CCC=CCC(O[Si](C)(C)C(C)(C)C)C1CC2OC(C(O)C#C[Si](C)(C)C)CC2O1 |
| InChI | InChI=1S/C24H44O4Si2/c1-10-11-12-13-19(28-30(8,9)24(2,3)4)21-17-23-22(27-21)16-20(26-23)18(25)14-15-29(5,6)7/h11-12,18-23,25H,10,13,16-17H2,1-9H3 |
| InChIKey | DEWRPLOYTYQCKN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.78 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|