C21H36O4Si — CID 10317669
(1R)-1-[(2R,3aR,5S,6aR)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]prop-2-yn-1-ol (PubChem CID 10317669) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (1R)-1-[(2R,3aR,5S,6aR)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]prop-2-yn-1-ol.
| Compound Name | (1R)-1-[(2R,3aR,5S,6aR)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 10317669 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (1R)-1-[(2R,3aR,5S,6aR)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]prop-2-yn-1-ol |
| SMILES | C#C[C@@H](O)[C@@H]1C[C@H]2O[C@@H]([C@H](C/C=C/CC)O[Si](C)(C)C(C)(C)C)C[C@H]2O1 |
| InChI | InChI=1S/C21H36O4Si/c1-8-10-11-12-16(25-26(6,7)21(3,4)5)18-14-20-19(24-18)13-17(23-20)15(22)9-2/h2,10-11,15-20,22H,8,12-14H2,1,3-7H3/b11-10+/t15-,16+,17+,18-,19-,20-/m1/s1 |
| InChIKey | HXBRYSJYXXJXSQ-MIHABFDDSA-N |
| XLogP | 4.04 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|