C16H22N4O3S — CID 3545228
methyl 6-[2-(2-methylpropylcarbamothioyl)pyrazolidine-1-carbonyl]pyridine-3-carboxylate (PubChem CID 3545228) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is methyl 6-[2-(2-methylpropylcarbamothioyl)pyrazolidine-1-carbonyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[2-(2-methylpropylcarbamothioyl)pyrazolidine-1-carbonyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 3545228 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | methyl 6-[2-(2-methylpropylcarbamothioyl)pyrazolidine-1-carbonyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCCN2C(=S)NCC(C)C)nc1 |
| InChI | InChI=1S/C16H22N4O3S/c1-11(2)9-18-16(24)20-8-4-7-19(20)14(21)13-6-5-12(10-17-13)15(22)23-3/h5-6,10-11H,4,7-9H2,1-3H3,(H,18,24) |
| InChIKey | INBWUQBFZREDDK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|