C17H17N5O4 — CID 3777676
methyl 6-[2-(5-methylpyrazine-2-carbonyl)pyrazolidine-1-carbonyl]pyridine-3-carboxylate (PubChem CID 3777676) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is methyl 6-[2-(5-methylpyrazine-2-carbonyl)pyrazolidine-1-carbonyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[2-(5-methylpyrazine-2-carbonyl)pyrazolidine-1-carbonyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 3777676 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | methyl 6-[2-(5-methylpyrazine-2-carbonyl)pyrazolidine-1-carbonyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCCN2C(=O)c2cnc(C)cn2)nc1 |
| InChI | InChI=1S/C17H17N5O4/c1-11-8-19-14(10-18-11)16(24)22-7-3-6-21(22)15(23)13-5-4-12(9-20-13)17(25)26-2/h4-5,8-10H,3,6-7H2,1-2H3 |
| InChIKey | XXJUYEOIHPGTCT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 105.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |