C23H24FN3O3S — CID 3546093
N-(1,3-benzodioxol-5-ylmethyl)-2-[1-butyl-5-(4-fluorophenyl)imidazol-2-yl]sulfanylacetamide (PubChem CID 3546093) has the molecular formula C23H24FN3O3S and a molecular weight of 441.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[1-butyl-5-(4-fluorophenyl)imidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[1-butyl-5-(4-fluorophenyl)imidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3546093 |
| Molecular Formula | C23H24FN3O3S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[1-butyl-5-(4-fluorophenyl)imidazol-2-yl]sulfanylacetamide |
| SMILES | CCCCn1c(-c2ccc(F)cc2)cnc1SCC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H24FN3O3S/c1-2-3-10-27-19(17-5-7-18(24)8-6-17)13-26-23(27)31-14-22(28)25-12-16-4-9-20-21(11-16)30-15-29-20/h4-9,11,13H,2-3,10,12,14-15H2,1H3,(H,25,28) |
| InChIKey | ALXNUHZPZQOZPE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|