C23H25N3O4S — CID 46815076
2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanyl-N-[(3-methoxyphenyl)methyl]acetamide (PubChem CID 46815076) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanyl-N-[(3-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanyl-N-[(3-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46815076 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanyl-N-[(3-methoxyphenyl)methyl]acetamide |
| SMILES | CCn1c(-c2ccc3c(c2)OCCO3)cnc1SCC(=O)NCc1cccc(OC)c1 |
| InChI | InChI=1S/C23H25N3O4S/c1-3-26-19(17-7-8-20-21(12-17)30-10-9-29-20)14-25-23(26)31-15-22(27)24-13-16-5-4-6-18(11-16)28-2/h4-8,11-12,14H,3,9-10,13,15H2,1-2H3,(H,24,27) |
| InChIKey | LBRKBKXKMBMHPB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|