C30H30N2O4S — CID 3547138
[2-ethoxy-4-[[3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] acetate (PubChem CID 3547138) has the molecular formula C30H30N2O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is [2-ethoxy-4-[[3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] acetate.
| Compound Name | [2-ethoxy-4-[[3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 3547138 |
| Molecular Formula | C30H30N2O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | [2-ethoxy-4-[[3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] acetate |
| SMILES | CCOc1cc(C=C2S/C(=N\c3ccccc3CC)N(c3ccccc3CC)C2=O)ccc1OC(C)=O |
| InChI | InChI=1S/C30H30N2O4S/c1-5-22-12-8-10-14-24(22)31-30-32(25-15-11-9-13-23(25)6-2)29(34)28(37-30)19-21-16-17-26(36-20(4)33)27(18-21)35-7-3/h8-19H,5-7H2,1-4H3/b28-19?,31-30- |
| InChIKey | LEMDFQJSBHQJBH-APRQGVHRSA-N |
| XLogP | 6.94 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|