C28H27BrN2O3S — CID 4231516
5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 4231516) has the molecular formula C28H27BrN2O3S and a molecular weight of 551.51 g/mol. Its IUPAC name is 5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4231516 |
| Molecular Formula | C28H27BrN2O3S |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-3-(2-ethylphenyl)-2-(2-ethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCc1ccccc1/N=C1\SC(=Cc2cc(Br)c(OC)c(OC)c2)C(=O)N1c1ccccc1CC |
| InChI | InChI=1S/C28H27BrN2O3S/c1-5-19-11-7-9-13-22(19)30-28-31(23-14-10-8-12-20(23)6-2)27(32)25(35-28)17-18-15-21(29)26(34-4)24(16-18)33-3/h7-17H,5-6H2,1-4H3/b25-17?,30-28- |
| InChIKey | LIMFHDHXDPEKCM-WHWJCEGFSA-N |
| XLogP | 7.40 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|