C22H32N4OS — CID 3548601
1-[2-methyl-4-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]heptan-1-one (PubChem CID 3548601) has the molecular formula C22H32N4OS and a molecular weight of 400.59 g/mol. Its IUPAC name is 1-[2-methyl-4-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]heptan-1-one.
| Compound Name | 1-[2-methyl-4-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 3548601 |
| Molecular Formula | C22H32N4OS |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-[2-methyl-4-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCN(c2nc(Cc3ccc(C)cc3)ns2)CC1C |
| InChI | InChI=1S/C22H32N4OS/c1-4-5-6-7-8-21(27)26-14-13-25(16-18(26)3)22-23-20(24-28-22)15-19-11-9-17(2)10-12-19/h9-12,18H,4-8,13-16H2,1-3H3 |
| InChIKey | LIRPFDOHGIGXDI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|