C21H29FN4OS — CID 3993237
1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-2-methylpiperazin-1-yl]heptan-1-one (PubChem CID 3993237) has the molecular formula C21H29FN4OS and a molecular weight of 404.56 g/mol. Its IUPAC name is 1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-2-methylpiperazin-1-yl]heptan-1-one.
| Compound Name | 1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-2-methylpiperazin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 3993237 |
| Molecular Formula | C21H29FN4OS |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-2-methylpiperazin-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCN(c2nc(Cc3ccc(F)cc3)ns2)CC1C |
| InChI | InChI=1S/C21H29FN4OS/c1-3-4-5-6-7-20(27)26-13-12-25(15-16(26)2)21-23-19(24-28-21)14-17-8-10-18(22)11-9-17/h8-11,16H,3-7,12-15H2,1-2H3 |
| InChIKey | FSXHFKRSQISRFG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|