C18H16ClN2O3+ — CID 3549006
5-[(4-chlorophenoxy)methyl]-N-(4-methylpyridin-1-ium-2-yl)furan-2-carboxamide (PubChem CID 3549006) has the molecular formula C18H16ClN2O3+ and a molecular weight of 343.79 g/mol. Its IUPAC name is 5-[(4-chlorophenoxy)methyl]-N-(4-methylpyridin-1-ium-2-yl)furan-2-carboxamide.
| Compound Name | 5-[(4-chlorophenoxy)methyl]-N-(4-methylpyridin-1-ium-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3549006 |
| Molecular Formula | C18H16ClN2O3+ |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 5-[(4-chlorophenoxy)methyl]-N-(4-methylpyridin-1-ium-2-yl)furan-2-carboxamide |
| SMILES | Cc1cc[nH+]c(NC(=O)c2ccc(COc3ccc(Cl)cc3)o2)c1 |
| InChI | InChI=1S/C18H15ClN2O3/c1-12-8-9-20-17(10-12)21-18(22)16-7-6-15(24-16)11-23-14-4-2-13(19)3-5-14/h2-10H,11H2,1H3,(H,20,21,22)/p+1 |
| InChIKey | AGMLPBPACSPWIL-UHFFFAOYSA-O |
| XLogP | 3.89 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |