C15H8Cl3N5OS — CID 35498960
5-(4-chlorophenyl)-3-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 35498960) has the molecular formula C15H8Cl3N5OS and a molecular weight of 412.69 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 5-(4-chlorophenyl)-3-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 35498960 |
| Molecular Formula | C15H8Cl3N5OS |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | Clc1ccc(-c2nc(CSc3nnc4c(Cl)cc(Cl)cn34)no2)cc1 |
| InChI | InChI=1S/C15H8Cl3N5OS/c16-9-3-1-8(2-4-9)14-19-12(22-24-14)7-25-15-21-20-13-11(18)5-10(17)6-23(13)15/h1-6H,7H2 |
| InChIKey | OLCHNVBDFLBXBG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |