C29H25BrCl2N2O6 — CID 3549939
2-benzyl-8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3549939) has the molecular formula C29H25BrCl2N2O6 and a molecular weight of 648.34 g/mol. Its IUPAC name is 2-benzyl-8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-benzyl-8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3549939 |
| Molecular Formula | C29H25BrCl2N2O6 |
| Molecular Weight | 648.34 g/mol |
| Exact Mass | 646.03 |
| IUPAC Name | 2-benzyl-8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(Cc5ccccc5)C(=O)C4C3CC3(Cl)C(=O)N(CBr)C(=O)C23Cl)cc1O |
| InChI | InChI=1S/C29H25BrCl2N2O6/c1-40-21-10-7-16(11-20(21)35)23-17-8-9-18-22(25(37)33(24(18)36)13-15-5-3-2-4-6-15)19(17)12-28(31)26(38)34(14-30)27(39)29(23,28)32/h2-8,10-11,18-19,22-23,35H,9,12-14H2,1H3 |
| InChIKey | DFEPOVJWFPQDAE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|