C28H23BrCl2N2O5 — CID 6644613
(3aS,6S,6aS,9aR,10aS,10bR)-2-benzyl-8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6644613) has the molecular formula C28H23BrCl2N2O5 and a molecular weight of 618.31 g/mol. Its IUPAC name is (3aS,6S,6aS,9aR,10aS,10bR)-2-benzyl-8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6S,6aS,9aR,10aS,10bR)-2-benzyl-8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6644613 |
| Molecular Formula | C28H23BrCl2N2O5 |
| Molecular Weight | 618.31 g/mol |
| Exact Mass | 616.02 |
| IUPAC Name | (3aS,6S,6aS,9aR,10aS,10bR)-2-benzyl-8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1[C@H]2[C@H](CC=C3[C@H]2C[C@@]2(Cl)C(=O)N(CBr)C(=O)[C@@]2(Cl)[C@H]3c2ccc(O)cc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H23BrCl2N2O5/c29-14-33-25(37)27(30)12-20-18(22(28(27,31)26(33)38)16-6-8-17(34)9-7-16)10-11-19-21(20)24(36)32(23(19)35)13-15-4-2-1-3-5-15/h1-10,19-22,34H,11-14H2/t19-,20+,21-,22-,27+,28-/m0/s1 |
| InChIKey | UQBNDBXKXLICIE-GVAJDMOFSA-N |
| XLogP | 4.30 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|