C24H21N5O2S — CID 35500322
2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1-(4-methoxyphenyl)benzimidazole (PubChem CID 35500322) has the molecular formula C24H21N5O2S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1-(4-methoxyphenyl)benzimidazole.
| Compound Name | 2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1-(4-methoxyphenyl)benzimidazole |
|---|---|
| PubChem CID | 35500322 |
| Molecular Formula | C24H21N5O2S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1-(4-methoxyphenyl)benzimidazole |
| SMILES | C=CCn1c(SCc2nc3ccccc3n2-c2ccc(OC)cc2)nnc1-c1ccco1 |
| InChI | InChI=1S/C24H21N5O2S/c1-3-14-28-23(21-9-6-15-31-21)26-27-24(28)32-16-22-25-19-7-4-5-8-20(19)29(22)17-10-12-18(30-2)13-11-17/h3-13,15H,1,14,16H2,2H3 |
| InChIKey | HFSAWOLNEYHYMV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 70.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|