C24H22N4O3S — CID 83275262
3-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-(4-methoxyphenyl)benzamide (PubChem CID 83275262) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 3-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 83275262 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-(4-methoxyphenyl)benzamide |
| SMILES | C=CCn1c(SCc2cccc(C(=O)Nc3ccc(OC)cc3)c2)nnc1-c1ccco1 |
| InChI | InChI=1S/C24H22N4O3S/c1-3-13-28-22(21-8-5-14-31-21)26-27-24(28)32-16-17-6-4-7-18(15-17)23(29)25-19-9-11-20(30-2)12-10-19/h3-12,14-15H,1,13,16H2,2H3,(H,25,29) |
| InChIKey | YXCQGUJITNLCLR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|