C25H24N4O2S — CID 83277590
N-(furan-2-ylmethyl)-3-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide (PubChem CID 83277590) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 83277590 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide |
| SMILES | C=CCn1c(SCc2cccc(C(=O)NCc3ccco3)c2)nnc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C25H24N4O2S/c1-3-13-29-23(20-11-9-18(2)10-12-20)27-28-25(29)32-17-19-6-4-7-21(15-19)24(30)26-16-22-8-5-14-31-22/h3-12,14-15H,1,13,16-17H2,2H3,(H,26,30) |
| InChIKey | KIEAXFMOBDKERE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|