C21H24ClN3O4 — CID 3550936
4-[2-[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide (PubChem CID 3550936) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is 4-[2-[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide.
| Compound Name | 4-[2-[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 3550936 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-[2-[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCC(=O)NNC(=O)COc2ccc(Cl)c(C)c2)c1 |
| InChI | InChI=1S/C21H24ClN3O4/c1-13-4-5-14(2)18(10-13)23-19(26)8-9-20(27)24-25-21(28)12-29-16-6-7-17(22)15(3)11-16/h4-7,10-11H,8-9,12H2,1-3H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | LOLJAMWKJNICDA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|