C26H27N3O4 — CID 4513201
N-(2,5-dimethylphenyl)-4-oxo-4-[2-[2-(4-phenylphenoxy)acetyl]hydrazinyl]butanamide (PubChem CID 4513201) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-oxo-4-[2-[2-(4-phenylphenoxy)acetyl]hydrazinyl]butanamide.
| Compound Name | N-(2,5-dimethylphenyl)-4-oxo-4-[2-[2-(4-phenylphenoxy)acetyl]hydrazinyl]butanamide |
|---|---|
| PubChem CID | 4513201 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-oxo-4-[2-[2-(4-phenylphenoxy)acetyl]hydrazinyl]butanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCC(=O)NNC(=O)COc2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H27N3O4/c1-18-8-9-19(2)23(16-18)27-24(30)14-15-25(31)28-29-26(32)17-33-22-12-10-21(11-13-22)20-6-4-3-5-7-20/h3-13,16H,14-15,17H2,1-2H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | VHMKANCUMNUMID-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|