C20H23N3O4 — CID 3342447
N-(2,5-dimethylphenyl)-4-[2-(4-methoxybenzoyl)hydrazinyl]-4-oxobutanamide (PubChem CID 3342447) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-[2-(4-methoxybenzoyl)hydrazinyl]-4-oxobutanamide.
| Compound Name | N-(2,5-dimethylphenyl)-4-[2-(4-methoxybenzoyl)hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 3342447 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-[2-(4-methoxybenzoyl)hydrazinyl]-4-oxobutanamide |
| SMILES | COc1ccc(C(=O)NNC(=O)CCC(=O)Nc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C20H23N3O4/c1-13-4-5-14(2)17(12-13)21-18(24)10-11-19(25)22-23-20(26)15-6-8-16(27-3)9-7-15/h4-9,12H,10-11H2,1-3H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | WTWFUYHEFCDYHE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|