C19H19ClN4O5 — CID 3382868
4-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide (PubChem CID 3382868) has the molecular formula C19H19ClN4O5 and a molecular weight of 418.84 g/mol. Its IUPAC name is 4-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide.
| Compound Name | 4-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 3382868 |
| Molecular Formula | C19H19ClN4O5 |
| Molecular Weight | 418.84 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCC(=O)NNC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H19ClN4O5/c1-11-3-4-12(2)15(9-11)21-17(25)7-8-18(26)22-23-19(27)13-5-6-14(20)16(10-13)24(28)29/h3-6,9-10H,7-8H2,1-2H3,(H,21,25)(H,22,26)(H,23,27) |
| InChIKey | NDSOKHHUFBMBBJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|