C25H24ClN3O4 — CID 4512967
N-(3-chloro-2-methylphenyl)-4-oxo-4-[2-[2-(4-phenylphenoxy)acetyl]hydrazinyl]butanamide (PubChem CID 4512967) has the molecular formula C25H24ClN3O4 and a molecular weight of 465.94 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-4-oxo-4-[2-[2-(4-phenylphenoxy)acetyl]hydrazinyl]butanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-4-oxo-4-[2-[2-(4-phenylphenoxy)acetyl]hydrazinyl]butanamide |
|---|---|
| PubChem CID | 4512967 |
| Molecular Formula | C25H24ClN3O4 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-4-oxo-4-[2-[2-(4-phenylphenoxy)acetyl]hydrazinyl]butanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CCC(=O)NNC(=O)COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24ClN3O4/c1-17-21(26)8-5-9-22(17)27-23(30)14-15-24(31)28-29-25(32)16-33-20-12-10-19(11-13-20)18-6-3-2-4-7-18/h2-13H,14-16H2,1H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | SJZUHRVKMFKPJI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|