C18H24N6OS — CID 3551094
2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide (PubChem CID 3551094) has the molecular formula C18H24N6OS and a molecular weight of 372.50 g/mol. Its IUPAC name is 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 3551094 |
| Molecular Formula | C18H24N6OS |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide |
| SMILES | C=CCN1CCN(c2ccccc2NC(=O)CSc2nncn2C)CC1 |
| InChI | InChI=1S/C18H24N6OS/c1-3-8-23-9-11-24(12-10-23)16-7-5-4-6-15(16)20-17(25)13-26-18-21-19-14-22(18)2/h3-7,14H,1,8-13H2,2H3,(H,20,25) |
| InChIKey | LKWSDVIVWNYXBQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|