C30H24Br2ClFN2O8 — CID 3551576
methyl 8-(3-chloro-4-fluorophenyl)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 3551576) has the molecular formula C30H24Br2ClFN2O8 and a molecular weight of 754.79 g/mol. Its IUPAC name is methyl 8-(3-chloro-4-fluorophenyl)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 8-(3-chloro-4-fluorophenyl)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 3551576 |
| Molecular Formula | C30H24Br2ClFN2O8 |
| Molecular Weight | 754.79 g/mol |
| Exact Mass | 751.96 |
| IUPAC Name | methyl 8-(3-chloro-4-fluorophenyl)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4C(=O)N(c5ccc(F)c(Cl)c5)C(=O)C4(C)C3c3cc(OC)c(O)c(Br)c3Br)C2C1=O |
| InChI | InChI=1S/C30H24Br2ClFN2O8/c1-30-16(26(39)35(28(30)41)11-4-7-18(34)17(33)8-11)9-14-12(21(30)15-10-19(43-2)24(37)23(32)22(15)31)5-6-13-20(14)27(40)36(25(13)38)29(42)44-3/h4-5,7-8,10,13-14,16,20-21,37H,6,9H2,1-3H3 |
| InChIKey | NLKFDEZUTYOZCQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.79 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|