C13H24N2O3S — CID 35522626
[(2S)-2-methylpiperidin-1-yl]-[(3S)-1-methylsulfonylpiperidin-3-yl]methanone (PubChem CID 35522626) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is [(2S)-2-methylpiperidin-1-yl]-[(3S)-1-methylsulfonylpiperidin-3-yl]methanone.
| Compound Name | [(2S)-2-methylpiperidin-1-yl]-[(3S)-1-methylsulfonylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 35522626 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [(2S)-2-methylpiperidin-1-yl]-[(3S)-1-methylsulfonylpiperidin-3-yl]methanone |
| SMILES | C[C@H]1CCCCN1C(=O)[C@H]1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H24N2O3S/c1-11-6-3-4-9-15(11)13(16)12-7-5-8-14(10-12)19(2,17)18/h11-12H,3-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | NEAUTEPGWFQVDN-RYUDHWBXSA-N |
| XLogP | 1.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |