C12H21N3O4S — CID 63078843
3-methyl-4-(1-methylsulfonylpiperidine-3-carbonyl)piperazin-2-one (PubChem CID 63078843) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 3-methyl-4-(1-methylsulfonylpiperidine-3-carbonyl)piperazin-2-one.
| Compound Name | 3-methyl-4-(1-methylsulfonylpiperidine-3-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 63078843 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3-methyl-4-(1-methylsulfonylpiperidine-3-carbonyl)piperazin-2-one |
| SMILES | CC1C(=O)NCCN1C(=O)C1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H21N3O4S/c1-9-11(16)13-5-7-15(9)12(17)10-4-3-6-14(8-10)20(2,18)19/h9-10H,3-8H2,1-2H3,(H,13,16) |
| InChIKey | VGEMGSQNXRYLRY-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |