C19H21ClN4O2S — CID 35524471
5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]furan-2-carboxamide (PubChem CID 35524471) has the molecular formula C19H21ClN4O2S and a molecular weight of 404.92 g/mol. Its IUPAC name is 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]furan-2-carboxamide.
| Compound Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 35524471 |
| Molecular Formula | C19H21ClN4O2S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]furan-2-carboxamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)Nc3nc4c(s3)C[C@@H](C)CC4)o2)c(C)c1Cl |
| InChI | InChI=1S/C19H21ClN4O2S/c1-10-4-6-14-16(8-10)27-19(21-14)22-18(25)15-7-5-13(26-15)9-24-12(3)17(20)11(2)23-24/h5,7,10H,4,6,8-9H2,1-3H3,(H,21,22,25)/t10-/m0/s1 |
| InChIKey | HORMJFOHWZRVBU-JTQLQIEISA-N |
| XLogP | 4.63 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |