C19H22N4O2S — CID 45148711
5-[(2,5-dimethylimidazol-1-yl)methyl]-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)furan-2-carboxamide (PubChem CID 45148711) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 5-[(2,5-dimethylimidazol-1-yl)methyl]-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)furan-2-carboxamide.
| Compound Name | 5-[(2,5-dimethylimidazol-1-yl)methyl]-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 45148711 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 5-[(2,5-dimethylimidazol-1-yl)methyl]-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)furan-2-carboxamide |
| SMILES | Cc1cnc(C)n1Cc1ccc(C(=O)Nc2nc3c(s2)CC(C)CC3)o1 |
| InChI | InChI=1S/C19H22N4O2S/c1-11-4-6-15-17(8-11)26-19(21-15)22-18(24)16-7-5-14(25-16)10-23-12(2)9-20-13(23)3/h5,7,9,11H,4,6,8,10H2,1-3H3,(H,21,22,24) |
| InChIKey | XMMVQEKTPREDJS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |