C23H19N3O3 — CID 3553005
2-methylidene-4-(3-nitrophenyl)-5-oxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-3-carbonitrile (PubChem CID 3553005) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-methylidene-4-(3-nitrophenyl)-5-oxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-3-carbonitrile.
| Compound Name | 2-methylidene-4-(3-nitrophenyl)-5-oxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 3553005 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-methylidene-4-(3-nitrophenyl)-5-oxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-3-carbonitrile |
| SMILES | C=C1NC2=C(C(=O)CC(c3ccccc3)C2)C(c2cccc([N+](=O)[O-])c2)C1C#N |
| InChI | InChI=1S/C23H19N3O3/c1-14-19(13-24)22(16-8-5-9-18(10-16)26(28)29)23-20(25-14)11-17(12-21(23)27)15-6-3-2-4-7-15/h2-10,17,19,22,25H,1,11-12H2 |
| InChIKey | VRQYFTWWDAIGJN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|