C22H18F2N4O4S — CID 35536075
N-[2,4-difluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-oxochromene-6-sulfonamide (PubChem CID 35536075) has the molecular formula C22H18F2N4O4S and a molecular weight of 472.47 g/mol. Its IUPAC name is N-[2,4-difluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-oxochromene-6-sulfonamide.
| Compound Name | N-[2,4-difluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-oxochromene-6-sulfonamide |
|---|---|
| PubChem CID | 35536075 |
| Molecular Formula | C22H18F2N4O4S |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | N-[2,4-difluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-oxochromene-6-sulfonamide |
| SMILES | O=c1ccc2cc(S(=O)(=O)Nc3cc(-c4nnc5n4CCCCC5)c(F)cc3F)ccc2o1 |
| InChI | InChI=1S/C22H18F2N4O4S/c23-16-12-17(24)18(11-15(16)22-26-25-20-4-2-1-3-9-28(20)22)27-33(30,31)14-6-7-19-13(10-14)5-8-21(29)32-19/h5-8,10-12,27H,1-4,9H2 |
| InChIKey | HLNKMFLKKNCRLK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|