C19H17NO4S — CID 55544360
2-oxo-N-(5,6,7,8-tetrahydronaphthalen-1-yl)chromene-6-sulfonamide (PubChem CID 55544360) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-oxo-N-(5,6,7,8-tetrahydronaphthalen-1-yl)chromene-6-sulfonamide.
| Compound Name | 2-oxo-N-(5,6,7,8-tetrahydronaphthalen-1-yl)chromene-6-sulfonamide |
|---|---|
| PubChem CID | 55544360 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-oxo-N-(5,6,7,8-tetrahydronaphthalen-1-yl)chromene-6-sulfonamide |
| SMILES | O=c1ccc2cc(S(=O)(=O)Nc3cccc4c3CCCC4)ccc2o1 |
| InChI | InChI=1S/C19H17NO4S/c21-19-11-8-14-12-15(9-10-18(14)24-19)25(22,23)20-17-7-3-5-13-4-1-2-6-16(13)17/h3,5,7-12,20H,1-2,4,6H2 |
| InChIKey | NZXUMQOXFRQJSB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|