About N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide
N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide (PubChem CID 30784509) has the molecular formula C17H12BrNO6S
and a molecular weight of 438.26 g/mol. Its IUPAC name is N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide.
Molecular Properties
| Compound Name | N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide |
| PubChem CID | 30784509 |
| Molecular Formula | C17H12BrNO6S |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 436.96 |
| IUPAC Name | N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide |
| SMILES | O=c1ccc2cc(S(=O)(=O)Nc3cc4c(cc3Br)OCCO4)ccc2o1 |
| InChI | InChI=1S/C17H12BrNO6S/c18-12-8-15-16(24-6-5-23-15)9-13(12)19-26(21,22)11-2-3-14-10(7-11)1-4-17(20)25-14/h1-4,7-9,19H,5-6H2 |
| InChIKey | OYTLQKZPPBNRSA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide?
The IUPAC name of N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide (CID 30784509) is N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide.
What is the SMILES notation for N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide?
The canonical SMILES for N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide is O=c1ccc2cc(S(=O)(=O)Nc3cc4c(cc3Br)OCCO4)ccc2o1.
What is the InChIKey of N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide?
The InChIKey is OYTLQKZPPBNRSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12BrNO6S/c18-12-8-15-16(24-6-5-23-15)9-13(12)19-26(21,22)11-2-3-14-10(7-11)1-4-17(20)25-14/h1-4,7-9,19H,5-6H2.
What are the key properties of N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide?
N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide has a molecular weight of 438.26 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxochromene-6-sulfonamide is sourced from PubChem (CID 30784509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).