C19H17NO6S — CID 55544736
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-oxochromene-6-sulfonamide (PubChem CID 55544736) has the molecular formula C19H17NO6S and a molecular weight of 387.41 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-oxochromene-6-sulfonamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-oxochromene-6-sulfonamide |
|---|---|
| PubChem CID | 55544736 |
| Molecular Formula | C19H17NO6S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-oxochromene-6-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc2oc(=O)ccc2c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H17NO6S/c1-12(13-2-5-17-18(11-13)25-9-8-24-17)20-27(22,23)15-4-6-16-14(10-15)3-7-19(21)26-16/h2-7,10-12,20H,8-9H2,1H3 |
| InChIKey | UXUHKPGAPGGWPK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|